C26H50O2Si2 — CID 101473266
[(2R)-2-[(3S,4Z)-3-ethenyl-3-methyl-4-(1-trimethylsilylbut-3-enylidene)oxolan-2-yl]propoxy]-tri(propan-2-yl)silane (PubChem CID 101473266) has the molecular formula C26H50O2Si2 and a molecular weight of 450.86 g/mol. Its IUPAC name is [(2R)-2-[(3S,4Z)-3-ethenyl-3-methyl-4-(1-trimethylsilylbut-3-enylidene)oxolan-2-yl]propoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2R)-2-[(3S,4Z)-3-ethenyl-3-methyl-4-(1-trimethylsilylbut-3-enylidene)oxolan-2-yl]propoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101473266 |
| Molecular Formula | C26H50O2Si2 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | [(2R)-2-[(3S,4Z)-3-ethenyl-3-methyl-4-(1-trimethylsilylbut-3-enylidene)oxolan-2-yl]propoxy]-tri(propan-2-yl)silane |
| SMILES | C=CC/C(=C1/COC([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)[C@@]1(C)C=C)[Si](C)(C)C |
| InChI | InChI=1S/C26H50O2Si2/c1-14-16-24(29(11,12)13)23-18-27-25(26(23,10)15-2)22(9)17-28-30(19(3)4,20(5)6)21(7)8/h14-15,19-22,25H,1-2,16-18H2,3-13H3/b24-23+/t22-,25?,26+/m1/s1 |
| InChIKey | CPFBUHROGCVCMJ-DDEOLSJPSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|