C22H40O2Si2 — CID 135071647
tert-butyl-dimethyl-[[(1R,2S)-4-methyl-2-prop-2-enoxy-1-(2-trimethylsilylethynyl)cyclohex-3-en-1-yl]methoxy]silane (PubChem CID 135071647) has the molecular formula C22H40O2Si2 and a molecular weight of 392.73 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2S)-4-methyl-2-prop-2-enoxy-1-(2-trimethylsilylethynyl)cyclohex-3-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2S)-4-methyl-2-prop-2-enoxy-1-(2-trimethylsilylethynyl)cyclohex-3-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 135071647 |
| Molecular Formula | C22H40O2Si2 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2S)-4-methyl-2-prop-2-enoxy-1-(2-trimethylsilylethynyl)cyclohex-3-en-1-yl]methoxy]silane |
| SMILES | C=CCO[C@H]1C=C(C)CC[C@@]1(C#C[Si](C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O2Si2/c1-11-15-23-20-17-19(2)12-13-22(20,14-16-25(6,7)8)18-24-26(9,10)21(3,4)5/h11,17,20H,1,12-13,15,18H2,2-10H3/t20-,22+/m0/s1 |
| InChIKey | KXIXCLLGUZZCBV-RBBKRZOGSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|