C20H40O2Si2 — CID 101241168
trimethyl-[(4R)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-trimethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane (PubChem CID 101241168) has the molecular formula C20H40O2Si2 and a molecular weight of 368.71 g/mol. Its IUPAC name is trimethyl-[(4R)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-trimethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane.
| Compound Name | trimethyl-[(4R)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-trimethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane |
|---|---|
| PubChem CID | 101241168 |
| Molecular Formula | C20H40O2Si2 |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | trimethyl-[(4R)-4-methyl-2-methylidene-5-[(2R,6R)-6-(2-trimethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane |
| SMILES | C=C(C[C@@H](C)C[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C20H40O2Si2/c1-17(14-18(2)16-23(3,4)5)15-20-11-9-10-19(22-20)12-13-21-24(6,7)8/h9-10,17,19-20H,2,11-16H2,1,3-8H3/t17-,19+,20+/m1/s1 |
| InChIKey | ZQNMEUIZQXHFHG-HOJAQTOUSA-N |
| XLogP | 6.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|