C18H35BrO2Si — CID 134883618
[(2S,3R,4S,6S)-2-(2-bromoethyl)-3-methyl-6-(2-methylprop-1-enyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134883618) has the molecular formula C18H35BrO2Si and a molecular weight of 391.47 g/mol. Its IUPAC name is [(2S,3R,4S,6S)-2-(2-bromoethyl)-3-methyl-6-(2-methylprop-1-enyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4S,6S)-2-(2-bromoethyl)-3-methyl-6-(2-methylprop-1-enyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134883618 |
| Molecular Formula | C18H35BrO2Si |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [(2S,3R,4S,6S)-2-(2-bromoethyl)-3-methyl-6-(2-methylprop-1-enyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)=C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](CCBr)O1 |
| InChI | InChI=1S/C18H35BrO2Si/c1-13(2)11-15-12-17(14(3)16(20-15)9-10-19)21-22(7,8)18(4,5)6/h11,14-17H,9-10,12H2,1-8H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | MITQYFFCHAXDGN-NCOADZHNSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|