C23H46O2Si2 — CID 101169861
tert-butyl-dimethyl-[2-[(2R,6R)-2-[(2R)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane (PubChem CID 101169861) has the molecular formula C23H46O2Si2 and a molecular weight of 410.79 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[(2R,6R)-2-[(2R)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[(2R,6R)-2-[(2R)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane |
|---|---|
| PubChem CID | 101169861 |
| Molecular Formula | C23H46O2Si2 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | tert-butyl-dimethyl-[2-[(2R,6R)-2-[(2R)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane |
| SMILES | C=C(C[C@@H](C)C[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C23H46O2Si2/c1-19(16-20(2)18-26(6,7)8)17-22-13-11-12-21(25-22)14-15-24-27(9,10)23(3,4)5/h11-12,19,21-22H,2,13-18H2,1,3-10H3/t19-,21+,22+/m1/s1 |
| InChIKey | XXWIWQMGWRHIQI-HJNYFJLDSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|