C35H70O3SiSn — CID 134949104
tert-butyl-dimethyl-[(E,6R)-5-methyl-6-[(4S,5S,6R)-2,2,5-trimethyl-6-[(Z)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]hept-4-enoxy]silane (PubChem CID 134949104) has the molecular formula C35H70O3SiSn and a molecular weight of 685.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,6R)-5-methyl-6-[(4S,5S,6R)-2,2,5-trimethyl-6-[(Z)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]hept-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,6R)-5-methyl-6-[(4S,5S,6R)-2,2,5-trimethyl-6-[(Z)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]hept-4-enoxy]silane |
|---|---|
| PubChem CID | 134949104 |
| Molecular Formula | C35H70O3SiSn |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 686.41 |
| IUPAC Name | tert-butyl-dimethyl-[(E,6R)-5-methyl-6-[(4S,5S,6R)-2,2,5-trimethyl-6-[(Z)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]hept-4-enoxy]silane |
| SMILES | CCCC[Sn](/C=C\[C@@H]1OC(C)(C)O[C@@H]([C@H](C)/C(C)=C/CCCO[Si](C)(C)C(C)(C)C)[C@@H]1C)(CCCC)CCCC |
| InChI | InChI=1S/C23H43O3Si.3C4H9.Sn/c1-12-20-19(4)21(26-23(8,9)25-20)18(3)17(2)15-13-14-16-24-27(10,11)22(5,6)7;3*1-3-4-2;/h1,12,15,18-21H,13-14,16H2,2-11H3;3*1,3-4H2,2H3;/b12-1?,17-15+;;;;/t18-,19-,20+,21+;;;;/m1..../s1 |
| InChIKey | AJHRYIDKDNOJGI-YWGQYOCNSA-N |
| XLogP | 11.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|