C28H49IO4Si — CID 10886578
tert-butyl-[(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoxy]-dimethylsilane (PubChem CID 10886578) has the molecular formula C28H49IO4Si and a molecular weight of 604.69 g/mol. Its IUPAC name is tert-butyl-[(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10886578 |
| Molecular Formula | C28H49IO4Si |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | tert-butyl-[(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoxy]-dimethylsilane |
| SMILES | CO[C@@H](/C=C/C=C/C=C/C[C@@H]1OC(C)(C)O[C@@H](/C(C)=C\CI)[C@H]1C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H49IO4Si/c1-22(18-20-29)26-23(2)25(32-28(6,7)33-26)17-15-13-11-12-14-16-24(30-8)19-21-31-34(9,10)27(3,4)5/h11-16,18,23-26H,17,19-21H2,1-10H3/b12-11+,15-13+,16-14+,22-18-/t23-,24-,25-,26-/m0/s1 |
| InChIKey | LCJBBPSGMZCKLH-PSYLVESISA-N |
| XLogP | 8.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|