C33H58O6Si — CID 134982257
[(Z)-3-[(5S)-6-[(2E,4E,6E,8R)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate (PubChem CID 134982257) has the molecular formula C33H58O6Si and a molecular weight of 578.91 g/mol. Its IUPAC name is [(Z)-3-[(5S)-6-[(2E,4E,6E,8R)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-3-[(5S)-6-[(2E,4E,6E,8R)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134982257 |
| Molecular Formula | C33H58O6Si |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | [(Z)-3-[(5S)-6-[(2E,4E,6E,8R)-10-[tert-butyl(dimethyl)silyl]oxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H](/C=C/C=C/C=C/CC1OC(C)(C)OC(/C(C)=C\COC(=O)C(C)(C)C)[C@H]1C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H58O6Si/c1-25(21-23-36-30(34)31(3,4)5)29-26(2)28(38-33(9,10)39-29)20-18-16-14-15-17-19-27(35-11)22-24-37-40(12,13)32(6,7)8/h14-19,21,26-29H,20,22-24H2,1-13H3/b15-14+,18-16+,19-17+,25-21-/t26-,27-,28?,29?/m0/s1 |
| InChIKey | HPXYYESCFAXKIO-LPABFWQASA-N |
| XLogP | 8.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|