C33H62O6Si — CID 11017333
[(2R,3S,4S,6E,8E,10S)-3-[diethyl(propan-2-yl)silyl]oxy-10-methoxy-2,4,6-trimethyl-10-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]deca-6,8-dienyl] 2,2-dimethylpropanoate (PubChem CID 11017333) has the molecular formula C33H62O6Si and a molecular weight of 582.94 g/mol. Its IUPAC name is [(2R,3S,4S,6E,8E,10S)-3-[diethyl(propan-2-yl)silyl]oxy-10-methoxy-2,4,6-trimethyl-10-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]deca-6,8-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,6E,8E,10S)-3-[diethyl(propan-2-yl)silyl]oxy-10-methoxy-2,4,6-trimethyl-10-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]deca-6,8-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11017333 |
| Molecular Formula | C33H62O6Si |
| Molecular Weight | 582.94 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | [(2R,3S,4S,6E,8E,10S)-3-[diethyl(propan-2-yl)silyl]oxy-10-methoxy-2,4,6-trimethyl-10-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]deca-6,8-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(O[C@H]([C@H](C)COC(=O)C(C)(C)C)[C@@H](C)C/C(C)=C/C=C/[C@H](OC)[C@@H]1OC(C)(C)OC[C@@H]1C)C(C)C |
| InChI | InChI=1S/C33H62O6Si/c1-15-40(16-2,23(3)4)39-29(26(7)21-36-31(34)32(9,10)11)25(6)20-24(5)18-17-19-28(35-14)30-27(8)22-37-33(12,13)38-30/h17-19,23,25-30H,15-16,20-22H2,1-14H3/b19-17+,24-18+/t25-,26+,27-,28-,29-,30+/m0/s1 |
| InChIKey | KZHNSVYEHQKGRH-PFUNQQAVSA-N |
| XLogP | 8.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.94 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|