C33H60O5Si — CID 56590591
ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate (PubChem CID 56590591) has the molecular formula C33H60O5Si and a molecular weight of 564.92 g/mol. Its IUPAC name is ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 56590591 |
| Molecular Formula | C33H60O5Si |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@H](C)[C@@H](/C(C)=C/C=C/[C@@H](C)C/C(C)=C/[C@H](C)[C@@H](OC)[C@@H](C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C33H60O5Si/c1-14-36-30(34)22-29-19-18-26(5)31(37-29)25(4)17-15-16-23(2)20-24(3)21-27(6)32(35-11)28(7)38-39(12,13)33(8,9)10/h15-17,21,23,26-29,31-32H,14,18-20,22H2,1-13H3/b16-15+,24-21+,25-17+/t23-,26+,27+,28-,29-,31-,32-/m1/s1 |
| InChIKey | VLIPIWCABWZQBL-XKBXHOBQSA-N |
| XLogP | 8.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|