C28H50O6Si — CID 134900066
methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]oxan-2-yl]-4-methylocta-2,4-dienoate (PubChem CID 134900066) has the molecular formula C28H50O6Si and a molecular weight of 510.79 g/mol. Its IUPAC name is methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]oxan-2-yl]-4-methylocta-2,4-dienoate.
| Compound Name | methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]oxan-2-yl]-4-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 134900066 |
| Molecular Formula | C28H50O6Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3R)-2-methoxy-3-methyl-4-oxopentyl]oxan-2-yl]-4-methylocta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C(C)=C/C[C@@H](C[C@@H]1CCC[C@@H](C[C@H](OC)[C@@H](C)C(C)=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O6Si/c1-20(15-17-27(30)32-8)14-16-25(34-35(9,10)28(4,5)6)18-23-12-11-13-24(33-23)19-26(31-7)21(2)22(3)29/h14-15,17,21,23-26H,11-13,16,18-19H2,1-10H3/b17-15+,20-14+/t21-,23-,24-,25-,26-/m0/s1 |
| InChIKey | KFKXDKYTTLLADB-IAFLPCHESA-N |
| XLogP | 6.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|