C52H98O5Si3 — CID 56930163
[(5R,7S,8E,10E)-5,9-dimethylhexadeca-8,10-dien-2-yn-7-yl] (2R,3R,5S,8S,9S)-3,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethyltetradec-12-ynoate (PubChem CID 56930163) has the molecular formula C52H98O5Si3 and a molecular weight of 887.61 g/mol. Its IUPAC name is [(5R,7S,8E,10E)-5,9-dimethylhexadeca-8,10-dien-2-yn-7-yl] (2R,3R,5S,8S,9S)-3,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethyltetradec-12-ynoate.
| Compound Name | [(5R,7S,8E,10E)-5,9-dimethylhexadeca-8,10-dien-2-yn-7-yl] (2R,3R,5S,8S,9S)-3,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethyltetradec-12-ynoate |
|---|---|
| PubChem CID | 56930163 |
| Molecular Formula | C52H98O5Si3 |
| Molecular Weight | 887.61 g/mol |
| Exact Mass | 886.67 |
| IUPAC Name | [(5R,7S,8E,10E)-5,9-dimethylhexadeca-8,10-dien-2-yn-7-yl] (2R,3R,5S,8S,9S)-3,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethyltetradec-12-ynoate |
| SMILES | CC#CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC[C@H](C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O[C@H](/C=C(C)/C=C/CCCCC)C[C@H](C)CC#CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C52H98O5Si3/c1-23-26-29-30-32-34-42(5)39-45(38-41(4)33-28-25-3)54-49(53)44(7)48(57-60(21,22)52(14,15)16)40-43(6)36-37-47(56-59(19,20)51(11,12)13)46(35-31-27-24-2)55-58(17,18)50(8,9)10/h32,34,39,41,43-48H,23,26,29-31,33,35-38,40H2,1-22H3/b34-32+,42-39+/t41-,43+,44-,45+,46+,47+,48-/m1/s1 |
| InChIKey | DIMVKLGSFBLHHB-UTNKQSNBSA-N |
| XLogP | 15.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.61 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|