C27H47IO4Si — CID 11039216
[(3E,5Z)-6-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]-5-methylhexa-3,5-dienyl] 2,2-dimethylpropanoate (PubChem CID 11039216) has the molecular formula C27H47IO4Si and a molecular weight of 590.66 g/mol. Its IUPAC name is [(3E,5Z)-6-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]-5-methylhexa-3,5-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(3E,5Z)-6-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]-5-methylhexa-3,5-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11039216 |
| Molecular Formula | C27H47IO4Si |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | [(3E,5Z)-6-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-3-iodoprop-2-enyl]-3-methyloxan-2-yl]-5-methylhexa-3,5-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(=C/[C@@H]1O[C@H](C/C=C/I)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C)/C=C/CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H47IO4Si/c1-20(14-11-12-17-30-25(29)26(3,4)5)18-23-21(2)24(19-22(31-23)15-13-16-28)32-33(9,10)27(6,7)8/h11,13-14,16,18,21-24H,12,15,17,19H2,1-10H3/b14-11+,16-13+,20-18-/t21-,22-,23+,24-/m1/s1 |
| InChIKey | XHGZMJUZCMIUJP-VXJWHBANSA-N |
| XLogP | 7.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|