C24H43IO4Si — CID 134843266
tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate (PubChem CID 134843266) has the molecular formula C24H43IO4Si and a molecular weight of 550.59 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134843266 |
| Molecular Formula | C24H43IO4Si |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate |
| SMILES | C[C@@H](/C=C/I)C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](C/C=C/C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C24H43IO4Si/c1-18(13-14-25)15-20-17-21(29-30(8,9)24(5,6)7)16-19(27-20)11-10-12-22(26)28-23(2,3)4/h10,12-14,18-21H,11,15-17H2,1-9H3/b12-10+,14-13+/t18-,19-,20+,21+/m0/s1 |
| InChIKey | FVXKBHBZEHFSSG-IKOOPOGPSA-N |
| XLogP | 7.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|