C18H29IO4 — CID 132580154
tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate (PubChem CID 132580154) has the molecular formula C18H29IO4 and a molecular weight of 436.33 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 132580154 |
| Molecular Formula | C18H29IO4 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(E,2R)-4-iodo-2-methylbut-3-enyl]oxan-2-yl]but-2-enoate |
| SMILES | C[C@@H](/C=C/I)C[C@@H]1C[C@H](O)C[C@H](C/C=C/C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C18H29IO4/c1-13(8-9-19)10-16-12-14(20)11-15(22-16)6-5-7-17(21)23-18(2,3)4/h5,7-9,13-16,20H,6,10-12H2,1-4H3/b7-5+,9-8+/t13-,14+,15-,16+/m0/s1 |
| InChIKey | RXIWHRYWHWZCOL-ZKNOGZQLSA-N |
| XLogP | 4.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|