C16H30O4 — CID 163069739
methyl (4R,6S,8R,10S)-8,10-dihydroxy-2,4,6,8-tetramethylundec-2-enoate (PubChem CID 163069739) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is methyl (4R,6S,8R,10S)-8,10-dihydroxy-2,4,6,8-tetramethylundec-2-enoate.
| Compound Name | methyl (4R,6S,8R,10S)-8,10-dihydroxy-2,4,6,8-tetramethylundec-2-enoate |
|---|---|
| PubChem CID | 163069739 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | methyl (4R,6S,8R,10S)-8,10-dihydroxy-2,4,6,8-tetramethylundec-2-enoate |
| SMILES | COC(=O)C(C)=C[C@H](C)C[C@H](C)C[C@@](C)(O)C[C@H](C)O |
| InChI | InChI=1S/C16H30O4/c1-11(8-13(3)15(18)20-6)7-12(2)9-16(5,19)10-14(4)17/h8,11-12,14,17,19H,7,9-10H2,1-6H3/t11-,12+,14+,16-/m1/s1 |
| InChIKey | IQQFJADQXWBZGX-TWJWRFFLSA-N |
| XLogP | 2.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|