C29H46O7 — CID 23656635
(3Z,5R,6S,7E,10S,12Z,15R,16E,19S,20R)-6,10,15-trihydroxy-20-[(2S,3S)-3-hydroxy-2-methylbutyl]-4,5,12,15,19-pentamethyl-1-oxacycloicosa-3,7,12,16-tetraene-2,14-dione (PubChem CID 23656635) has the molecular formula C29H46O7 and a molecular weight of 506.68 g/mol. Its IUPAC name is (3Z,5R,6S,7E,10S,12Z,15R,16E,19S,20R)-6,10,15-trihydroxy-20-[(2S,3S)-3-hydroxy-2-methylbutyl]-4,5,12,15,19-pentamethyl-1-oxacycloicosa-3,7,12,16-tetraene-2,14-dione.
| Compound Name | (3Z,5R,6S,7E,10S,12Z,15R,16E,19S,20R)-6,10,15-trihydroxy-20-[(2S,3S)-3-hydroxy-2-methylbutyl]-4,5,12,15,19-pentamethyl-1-oxacycloicosa-3,7,12,16-tetraene-2,14-dione |
|---|---|
| PubChem CID | 23656635 |
| Molecular Formula | C29H46O7 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | (3Z,5R,6S,7E,10S,12Z,15R,16E,19S,20R)-6,10,15-trihydroxy-20-[(2S,3S)-3-hydroxy-2-methylbutyl]-4,5,12,15,19-pentamethyl-1-oxacycloicosa-3,7,12,16-tetraene-2,14-dione |
| SMILES | C/C1=C/C(=O)[C@](C)(O)/C=C/C[C@H](C)[C@@H](C[C@H](C)[C@H](C)O)OC(=O)/C=C(/C)[C@@H](C)[C@@H](O)/C=C/C[C@H](O)C1 |
| InChI | InChI=1S/C29H46O7/c1-18-14-24(31)11-8-12-25(32)22(5)20(3)17-28(34)36-26(16-21(4)23(6)30)19(2)10-9-13-29(7,35)27(33)15-18/h8-9,12-13,15,17,19,21-26,30-32,35H,10-11,14,16H2,1-7H3/b12-8+,13-9+,18-15-,20-17-/t19-,21-,22+,23-,24-,25-,26+,29+/m0/s1 |
| InChIKey | BJCWEMHNHLDTHU-KGFRGHSESA-N |
| XLogP | 3.81 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|