C23H44O5Si — CID 134843265
tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-hydroxy-2-methylpropyl]oxan-2-yl]but-2-enoate (PubChem CID 134843265) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-hydroxy-2-methylpropyl]oxan-2-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-hydroxy-2-methylpropyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134843265 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-hydroxy-2-methylpropyl]oxan-2-yl]but-2-enoate |
| SMILES | C[C@@H](CO)C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](C/C=C/C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C23H44O5Si/c1-17(16-24)13-19-15-20(28-29(8,9)23(5,6)7)14-18(26-19)11-10-12-21(25)27-22(2,3)4/h10,12,17-20,24H,11,13-16H2,1-9H3/b12-10+/t17-,18+,19-,20-/m1/s1 |
| InChIKey | CNGUBSSQFSDCSQ-KCFPBJEMSA-N |
| XLogP | 5.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|