C21H40O4Si — CID 53362986
ethyl (E,4R)-4-[(1R,2S)-2-(hydroxymethyl)cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate (PubChem CID 53362986) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(1R,2S)-2-(hydroxymethyl)cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(1R,2S)-2-(hydroxymethyl)cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate |
|---|---|
| PubChem CID | 53362986 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethyl (E,4R)-4-[(1R,2S)-2-(hydroxymethyl)cyclopentyl]-4-tri(propan-2-yl)silyloxybut-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC[C@@H]1CO |
| InChI | InChI=1S/C21H40O4Si/c1-8-24-21(23)13-12-20(19-11-9-10-18(19)14-22)25-26(15(2)3,16(4)5)17(6)7/h12-13,15-20,22H,8-11,14H2,1-7H3/b13-12+/t18-,19-,20-/m1/s1 |
| InChIKey | QVWZGTRLQNCDMR-YRTPNZHLSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|