C17H26O4 — CID 71761859
(1R,2R,3E,7S,11E,13S,15S)-7-ethyl-2,15-dihydroxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71761859) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,2R,3E,7S,11E,13S,15S)-7-ethyl-2,15-dihydroxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7S,11E,13S,15S)-7-ethyl-2,15-dihydroxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71761859 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (1R,2R,3E,7S,11E,13S,15S)-7-ethyl-2,15-dihydroxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | CC[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C17H26O4/c1-2-14-7-5-3-4-6-12-10-13(18)11-15(12)16(19)8-9-17(20)21-14/h4,6,8-9,12-16,18-19H,2-3,5,7,10-11H2,1H3/b6-4+,9-8+/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | UAXNYZPENRXDKY-MAPQJVESSA-N |
| XLogP | 2.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|