C23H42O7Si — CID 101368659
methyl (E,4S,5R)-5-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]-4-hydroxyhex-2-enoate (PubChem CID 101368659) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is methyl (E,4S,5R)-5-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]-4-hydroxyhex-2-enoate.
| Compound Name | methyl (E,4S,5R)-5-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]-4-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 101368659 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | methyl (E,4S,5R)-5-[(5aR,7S,8S,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepin-7-yl]-4-hydroxyhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O)[C@@H](C)[C@@H]1O[C@@H]2CCOC(C)(C)O[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O7Si/c1-15(16(24)10-11-20(25)26-7)21-19(30-31(8,9)22(2,3)4)14-18-17(28-21)12-13-27-23(5,6)29-18/h10-11,15-19,21,24H,12-14H2,1-9H3/b11-10+/t15-,16+,17-,18-,19+,21+/m1/s1 |
| InChIKey | CXMFUMBTMYIRCJ-HUBDVBCRSA-N |
| XLogP | 3.80 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|