C28H54O6Si2 — CID 11226527
methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(Z,1R)-1-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate (PubChem CID 11226527) has the molecular formula C28H54O6Si2 and a molecular weight of 542.91 g/mol. Its IUPAC name is methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(Z,1R)-1-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate.
| Compound Name | methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(Z,1R)-1-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 11226527 |
| Molecular Formula | C28H54O6Si2 |
| Molecular Weight | 542.91 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(Z,1R)-1-[tert-butyl(dimethyl)silyl]oxypent-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enoate |
| SMILES | C/C=C\C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@@H](C/C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O6Si2/c1-15-16-18-21(33-35(11,12)26(2,3)4)24-25(32-28(8,9)31-24)22(19-17-20-23(29)30-10)34-36(13,14)27(5,6)7/h15-17,20-22,24-25H,18-19H2,1-14H3/b16-15-,20-17-/t21-,22-,24-,25-/m1/s1 |
| InChIKey | FGVQRUOSZBRVPB-MKUIHLJJSA-N |
| XLogP | 7.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.91 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|