C28H50O10Si — CID 67083311
trimethyl (Z,3R)-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-ene-1,2,3-tricarboxylate (PubChem CID 67083311) has the molecular formula C28H50O10Si and a molecular weight of 574.78 g/mol. Its IUPAC name is trimethyl (Z,3R)-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-ene-1,2,3-tricarboxylate.
| Compound Name | trimethyl (Z,3R)-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 67083311 |
| Molecular Formula | C28H50O10Si |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | trimethyl (Z,3R)-3-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyoctyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyprop-1-ene-1,2,3-tricarboxylate |
| SMILES | CCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@@](O)(C(=O)OC)/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C28H50O10Si/c1-12-13-14-15-16-17-20(38-39(10,11)26(2,3)4)22-23(37-27(5,6)36-22)28(32,25(31)35-9)19(24(30)34-8)18-21(29)33-7/h18,20,22-23,32H,12-17H2,1-11H3/b19-18+/t20-,22-,23+,28+/m0/s1 |
| InChIKey | RKBGWNHGWRCCAA-DWHFRLRJSA-N |
| XLogP | 4.43 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|