C20H42O4Si — CID 53230768
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 53230768) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 53230768 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CCCCCCC[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si/c1-9-10-11-12-13-14-16-18(23-20(5,6)22-16)17(15-21)24-25(7,8)19(2,3)4/h16-18,21H,9-15H2,1-8H3/t16-,17+,18-/m0/s1 |
| InChIKey | MXRDZQLYWPKGOS-KSZLIROESA-N |
| XLogP | 5.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|