C21H38O4 — CID 58429845
(1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 58429845) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 58429845 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | CCCCCCC#CCCCCCC[C@H]1OC(C)(C)O[C@H]1[C@@H](O)CO |
| InChI | InChI=1S/C21H38O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-19-20(18(23)17-22)25-21(2,3)24-19/h18-20,22-23H,4-8,11-17H2,1-3H3/t18-,19+,20-/m0/s1 |
| InChIKey | XLBBEDQLOQYKHQ-ZCNNSNEGSA-N |
| XLogP | 4.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|