C51H84O7 — CID 158069817
(1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propan-1-ol;[(1S)-1-[(4R,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propyl] benzoate (PubChem CID 158069817) has the molecular formula C51H84O7 and a molecular weight of 809.23 g/mol. Its IUPAC name is (1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propan-1-ol;[(1S)-1-[(4R,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propyl] benzoate.
| Compound Name | (1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propan-1-ol;[(1S)-1-[(4R,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propyl] benzoate |
|---|---|
| PubChem CID | 158069817 |
| Molecular Formula | C51H84O7 |
| Molecular Weight | 809.23 g/mol |
| Exact Mass | 808.62 |
| IUPAC Name | (1S)-1-[(4S,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propan-1-ol;[(1S)-1-[(4R,5R)-2,2-dimethyl-5-tetradec-7-ynyl-1,3-dioxolan-4-yl]propyl] benzoate |
| SMILES | CCCCCCC#CCCCCCC[C@H]1OC(C)(C)O[C@H]1[C@@H](O)CC.CCCCCCC#CCCCCCC[C@H]1OC(C)(C)O[C@H]1[C@H](CC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H44O4.C22H40O3/c1-5-7-8-9-10-11-12-13-14-15-16-20-23-26-27(33-29(3,4)32-26)25(6-2)31-28(30)24-21-18-17-19-22-24;1-5-7-8-9-10-11-12-13-14-15-16-17-18-20-21(19(23)6-2)25-22(3,4)24-20/h17-19,21-22,25-27H,5-10,13-16,20,23H2,1-4H3;19-21,23H,5-10,13-18H2,1-4H3/t25-,26+,27-;19-,20+,21-/m00/s1 |
| InChIKey | FLROJMSVIZNODZ-QTKIOWJTSA-N |
| XLogP | 13.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.23 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|