C29H36O4 — CID 123567766
[(3R)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-yl] 3-phenylprop-2-enoate (PubChem CID 123567766) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is [(3R)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-yl] 3-phenylprop-2-enoate.
| Compound Name | [(3R)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 123567766 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [(3R)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-4,6-diyn-3-yl] 3-phenylprop-2-enoate |
| SMILES | C=C[C@H](C#CC#CC[C@H]1OC(C)(C)O[C@@H]1CCCCCCC)OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C29H36O4/c1-5-7-8-9-15-20-26-27(33-29(3,4)32-26)21-16-11-14-19-25(6-2)31-28(30)23-22-24-17-12-10-13-18-24/h6,10,12-13,17-18,22-23,25-27H,2,5,7-9,15,20-21H2,1,3-4H3/t25-,26-,27-/m1/s1 |
| InChIKey | YGFYLBJSSSDFJZ-ZONZVBGPSA-N |
| XLogP | 6.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|