C21H32O3 — CID 91154566
8-(5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylocta-4,6-diyn-3-one (PubChem CID 91154566) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 8-(5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylocta-4,6-diyn-3-one.
| Compound Name | 8-(5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylocta-4,6-diyn-3-one |
|---|---|
| PubChem CID | 91154566 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 8-(5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylocta-4,6-diyn-3-one |
| SMILES | CCCCCCCC1OC(C)(C)OC1CC#CC#CC(=O)C(C)C |
| InChI | InChI=1S/C21H32O3/c1-6-7-8-9-12-15-19-20(24-21(4,5)23-19)16-13-10-11-14-18(22)17(2)3/h17,19-20H,6-9,12,15-16H2,1-5H3 |
| InChIKey | KEFKGRBGEBTQEQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|