C21H32O3 — CID 46184414
8-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyloct-1-en-4,6-diyn-3-ol (PubChem CID 46184414) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 8-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyloct-1-en-4,6-diyn-3-ol.
| Compound Name | 8-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyloct-1-en-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 46184414 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 8-[(4S,5S)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyloct-1-en-4,6-diyn-3-ol |
| SMILES | C=CC(C)(O)C#CC#CC[C@@H]1OC(C)(C)O[C@H]1CCCCCCC |
| InChI | InChI=1S/C21H32O3/c1-6-8-9-10-12-15-18-19(24-20(3,4)23-18)16-13-11-14-17-21(5,22)7-2/h7,18-19,22H,2,6,8-10,12,15-16H2,1,3-5H3/t18-,19-,21?/m0/s1 |
| InChIKey | QKECGRBXUVVQMC-CHEUHSMRSA-N |
| XLogP | 4.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|