C24H44O6 — CID 67840140
2-[9-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)nonyl]-4,4-dimethyl-1,3-dioxetane-2-carboxylic acid (PubChem CID 67840140) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is 2-[9-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)nonyl]-4,4-dimethyl-1,3-dioxetane-2-carboxylic acid.
| Compound Name | 2-[9-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)nonyl]-4,4-dimethyl-1,3-dioxetane-2-carboxylic acid |
|---|---|
| PubChem CID | 67840140 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 2-[9-(2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl)nonyl]-4,4-dimethyl-1,3-dioxetane-2-carboxylic acid |
| SMILES | CCCCCC1OC(C)(C)OC1CCCCCCCCCC1(C(=O)O)OC(C)(C)O1 |
| InChI | InChI=1S/C24H44O6/c1-6-7-13-16-19-20(28-22(2,3)27-19)17-14-11-9-8-10-12-15-18-24(21(25)26)29-23(4,5)30-24/h19-20H,6-18H2,1-5H3,(H,25,26) |
| InChIKey | WFWPIRKWTJRVED-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|