C30H39F3O5 — CID 56970325
[(3S)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]octa-4,6-diyn-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 56970325) has the molecular formula C30H39F3O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is [(3S)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]octa-4,6-diyn-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3S)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]octa-4,6-diyn-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 56970325 |
| Molecular Formula | C30H39F3O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | [(3S)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]octa-4,6-diyn-3-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCCC[C@H]1OC(C)(C)O[C@@H]1CC#CC#C[C@H](CC)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C30H39F3O5/c1-6-8-9-10-16-21-25-26(38-28(3,4)37-25)22-17-12-15-20-24(7-2)36-27(34)29(35-5,30(31,32)33)23-18-13-11-14-19-23/h11,13-14,18-19,24-26H,6-10,16,21-22H2,1-5H3/t24-,25+,26+,29-/m0/s1 |
| InChIKey | VDUPTAFYKLJDJZ-OSSDZZHWSA-N |
| XLogP | 6.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|