C29H38O4 — CID 91077949
10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl 3-phenylprop-2-enoate (PubChem CID 91077949) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl 3-phenylprop-2-enoate.
| Compound Name | 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 91077949 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 10-(2-hydroxypropan-2-yloxy)heptadec-1-en-4,6-diyn-3-yl 3-phenylprop-2-enoate |
| SMILES | C=CC(C#CC#CCCC(CCCCCCC)OC(C)(C)O)OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C29H38O4/c1-5-7-8-9-16-21-27(33-29(3,4)31)22-17-11-10-15-20-26(6-2)32-28(30)24-23-25-18-13-12-14-19-25/h6,12-14,18-19,23-24,26-27,31H,2,5,7-9,16-17,21-22H2,1,3-4H3 |
| InChIKey | REYKISBIQDDEGO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|