C23H32O4 — CID 145463052
ethene;2-non-8-en-5-yn-2-yloxypropan-2-ol;(E)-3-phenylprop-2-enoic acid (PubChem CID 145463052) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethene;2-non-8-en-5-yn-2-yloxypropan-2-ol;(E)-3-phenylprop-2-enoic acid.
| Compound Name | ethene;2-non-8-en-5-yn-2-yloxypropan-2-ol;(E)-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 145463052 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethene;2-non-8-en-5-yn-2-yloxypropan-2-ol;(E)-3-phenylprop-2-enoic acid |
| SMILES | C=C.C=CCC#CCCC(C)OC(C)(C)O.O=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H20O2.C9H8O2.C2H4/c1-5-6-7-8-9-10-11(2)14-12(3,4)13;10-9(11)7-6-8-4-2-1-3-5-8;1-2/h5,11,13H,1,6,9-10H2,2-4H3;1-7H,(H,10,11);1-2H2/b;7-6+; |
| InChIKey | FBOLODPQCOZCJB-FPCGKXSPSA-N |
| XLogP | 5.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|