C16H28O5 — CID 18658029
(1R)-1-[(4R,5R)-5-[(1R)-1-hydroxynon-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 18658029) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1R)-1-[(4R,5R)-5-[(1R)-1-hydroxynon-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(4R,5R)-5-[(1R)-1-hydroxynon-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 18658029 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1R)-1-[(4R,5R)-5-[(1R)-1-hydroxynon-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | CCCCCCC#C[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H](O)CO |
| InChI | InChI=1S/C16H28O5/c1-4-5-6-7-8-9-10-12(18)14-15(13(19)11-17)21-16(2,3)20-14/h12-15,17-19H,4-8,11H2,1-3H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | CKISMAGCBAMCOM-KBUPBQIOSA-N |
| XLogP | 1.19 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|