C23H42O5Si — CID 177388433
[(1R)-1-[(4R,5S)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate (PubChem CID 177388433) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate.
| Compound Name | [(1R)-1-[(4R,5S)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 177388433 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(1R)-1-[(4R,5S)-5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] prop-2-enoate |
| SMILES | C=CCC(OC(=O)C=C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1CCCC |
| InChI | InChI=1S/C23H42O5Si/c1-11-14-16-18-20(27-23(7,8)26-18)21(28-29(9,10)22(4,5)6)17(15-12-2)25-19(24)13-3/h12-13,17-18,20-21H,2-3,11,14-16H2,1,4-10H3/t17?,18-,20+,21+/m0/s1 |
| InChIKey | DIJLFFSUPMVIJH-LSMWDBJESA-N |
| XLogP | 5.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|