C23H40O5Si — CID 102395641
[(1Z)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-yl] prop-2-enoate (PubChem CID 102395641) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is [(1Z)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-yl] prop-2-enoate.
| Compound Name | [(1Z)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 102395641 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(1Z)-1-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]hexa-1,5-dien-3-yl] prop-2-enoate |
| SMILES | C=CCC(/C=C\[C@@H]1C[C@H]([C@H](C)O[Si](C)(C)C(C)(C)C)OC(C)(C)O1)OC(=O)C=C |
| InChI | InChI=1S/C23H40O5Si/c1-11-13-18(25-21(24)12-2)14-15-19-16-20(27-23(7,8)26-19)17(3)28-29(9,10)22(4,5)6/h11-12,14-15,17-20H,1-2,13,16H2,3-10H3/b15-14-/t17-,18?,19+,20+/m0/s1 |
| InChIKey | MSPRJSIOLCPNSA-YTHXTMRESA-N |
| XLogP | 5.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|