C26H50O6Si2 — CID 101222022
[(4R,5Z,7S,8R,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8,9-dihydroxyundeca-1,5-dien-4-yl] prop-2-enoate (PubChem CID 101222022) has the molecular formula C26H50O6Si2 and a molecular weight of 514.85 g/mol. Its IUPAC name is [(4R,5Z,7S,8R,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8,9-dihydroxyundeca-1,5-dien-4-yl] prop-2-enoate.
| Compound Name | [(4R,5Z,7S,8R,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8,9-dihydroxyundeca-1,5-dien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 101222022 |
| Molecular Formula | C26H50O6Si2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [(4R,5Z,7S,8R,9R,10S)-7,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8,9-dihydroxyundeca-1,5-dien-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C26H50O6Si2/c1-14-16-20(30-22(27)15-2)17-18-21(32-34(12,13)26(7,8)9)24(29)23(28)19(3)31-33(10,11)25(4,5)6/h14-15,17-21,23-24,28-29H,1-2,16H2,3-13H3/b18-17-/t19-,20+,21-,23-,24-/m0/s1 |
| InChIKey | NMPNWIDOLCNSRL-PHXHSKMBSA-N |
| XLogP | 5.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|