C23H40O5Si — CID 102243325
[(2S,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-(2,5,5-trimethyl-1,3-dioxan-2-yl)hepta-4,6-dien-3-yl] prop-2-enoate (PubChem CID 102243325) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is [(2S,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-(2,5,5-trimethyl-1,3-dioxan-2-yl)hepta-4,6-dien-3-yl] prop-2-enoate.
| Compound Name | [(2S,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-(2,5,5-trimethyl-1,3-dioxan-2-yl)hepta-4,6-dien-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 102243325 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(2S,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-(2,5,5-trimethyl-1,3-dioxan-2-yl)hepta-4,6-dien-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](/C=C/C=C/C1(C)OCC(C)(C)CO1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O5Si/c1-11-20(24)27-19(18(2)28-29(9,10)21(3,4)5)14-12-13-15-23(8)25-16-22(6,7)17-26-23/h11-15,18-19H,1,16-17H2,2-10H3/b14-12+,15-13+/t18-,19+/m0/s1 |
| InChIKey | KLDOUYUFVBPXFL-RGIKDIGWSA-N |
| XLogP | 5.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|