C11H23NO3Si — CID 141326729
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-formylbutanamide (PubChem CID 141326729) has the molecular formula C11H23NO3Si and a molecular weight of 245.40 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-formylbutanamide.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-formylbutanamide |
|---|---|
| PubChem CID | 141326729 |
| Molecular Formula | C11H23NO3Si |
| Molecular Weight | 245.40 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-formylbutanamide |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C(C=O)C(N)=O |
| InChI | InChI=1S/C11H23NO3Si/c1-8(9(7-13)10(12)14)15-16(5,6)11(2,3)4/h7-9H,1-6H3,(H2,12,14)/t8-,9?/m1/s1 |
| InChIKey | KYDPKJSUAARDGL-VEDVMXKPSA-N |
| XLogP | 1.70 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|