C14H30N4O2SSi — CID 10712632
(2S,3R)-2-[azido(propan-2-ylsulfanyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide (PubChem CID 10712632) has the molecular formula C14H30N4O2SSi and a molecular weight of 346.57 g/mol. Its IUPAC name is (2S,3R)-2-[azido(propan-2-ylsulfanyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide.
| Compound Name | (2S,3R)-2-[azido(propan-2-ylsulfanyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide |
|---|---|
| PubChem CID | 10712632 |
| Molecular Formula | C14H30N4O2SSi |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2S,3R)-2-[azido(propan-2-ylsulfanyl)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide |
| SMILES | CC(C)SC(N=[N+]=[N-])[C@H](C(N)=O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30N4O2SSi/c1-9(2)21-13(17-18-16)11(12(15)19)10(3)20-22(7,8)14(4,5)6/h9-11,13H,1-8H3,(H2,15,19)/t10-,11+,13?/m1/s1 |
| InChIKey | NCOIAWADJWSWDM-ILWADHIDSA-N |
| XLogP | 4.28 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|