C14H30O3SSi — CID 102374118
S-ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanethioate (PubChem CID 102374118) has the molecular formula C14H30O3SSi and a molecular weight of 306.54 g/mol. Its IUPAC name is S-ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanethioate.
| Compound Name | S-ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanethioate |
|---|---|
| PubChem CID | 102374118 |
| Molecular Formula | C14H30O3SSi |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | S-ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylpentanethioate |
| SMILES | CCSC(=O)[C@H](C)[C@@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3SSi/c1-9-18-13(16)10(2)12(15)11(3)17-19(7,8)14(4,5)6/h10-12,15H,9H2,1-8H3/t10-,11-,12-/m1/s1 |
| InChIKey | NSXGPOJLENOZAA-IJLUTSLNSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|