C14H25Cl3O3Si — CID 54592131
(E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trichloro-6-hydroxyoct-4-en-3-one (PubChem CID 54592131) has the molecular formula C14H25Cl3O3Si and a molecular weight of 375.80 g/mol. Its IUPAC name is (E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trichloro-6-hydroxyoct-4-en-3-one.
| Compound Name | (E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trichloro-6-hydroxyoct-4-en-3-one |
|---|---|
| PubChem CID | 54592131 |
| Molecular Formula | C14H25Cl3O3Si |
| Molecular Weight | 375.80 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trichloro-6-hydroxyoct-4-en-3-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)/C=C/C(=O)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H25Cl3O3Si/c1-10(20-21(5,6)13(2,3)4)12(19)8-7-11(18)9-14(15,16)17/h7-8,10,12,19H,9H2,1-6H3/b8-7+/t10-,12-/m1/s1 |
| InChIKey | KOSNGUXCCWFRQI-IOJZVYEBSA-N |
| XLogP | 4.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|