C12H23NO2Si — CID 10514274
(E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyhex-2-enenitrile (PubChem CID 10514274) has the molecular formula C12H23NO2Si and a molecular weight of 241.41 g/mol. Its IUPAC name is (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyhex-2-enenitrile.
| Compound Name | (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyhex-2-enenitrile |
|---|---|
| PubChem CID | 10514274 |
| Molecular Formula | C12H23NO2Si |
| Molecular Weight | 241.41 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyhex-2-enenitrile |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(O)/C=C/C#N |
| InChI | InChI=1S/C12H23NO2Si/c1-10(11(14)8-7-9-13)15-16(5,6)12(2,3)4/h7-8,10-11,14H,1-6H3/b8-7+/t10-,11?/m0/s1 |
| InChIKey | SQRYXZORXBJCTH-LHMHPJTCSA-N |
| XLogP | 2.84 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|