C14H25NO2Si — CID 11288616
(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-oxohex-2-enenitrile (PubChem CID 11288616) has the molecular formula C14H25NO2Si and a molecular weight of 267.44 g/mol. Its IUPAC name is (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-oxohex-2-enenitrile.
| Compound Name | (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-oxohex-2-enenitrile |
|---|---|
| PubChem CID | 11288616 |
| Molecular Formula | C14H25NO2Si |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-oxohex-2-enenitrile |
| SMILES | CC(C)(C=O)[C@H](/C=C/C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H25NO2Si/c1-13(2,3)18(6,7)17-12(9-8-10-15)14(4,5)11-16/h8-9,11-12H,1-7H3/b9-8+/t12-/m0/s1 |
| InChIKey | FLSYQRGSILXRSV-BCPZQOPPSA-N |
| XLogP | 3.68 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|