C21H42O2Si2 — CID 138980521
(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-tri(propan-2-yl)silylpent-4-ynal (PubChem CID 138980521) has the molecular formula C21H42O2Si2 and a molecular weight of 382.74 g/mol. Its IUPAC name is (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-tri(propan-2-yl)silylpent-4-ynal.
| Compound Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-tri(propan-2-yl)silylpent-4-ynal |
|---|---|
| PubChem CID | 138980521 |
| Molecular Formula | C21H42O2Si2 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-tri(propan-2-yl)silylpent-4-ynal |
| SMILES | CC(C)[Si](C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H42O2Si2/c1-16(2)25(17(3)4,18(5)6)14-13-20(19(7)15-22)23-24(11,12)21(8,9)10/h15-20H,1-12H3/t19-,20-/m0/s1 |
| InChIKey | QNJPKMRTWDTHQM-PMACEKPBSA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|