C18H36O2Si2 — CID 11067797
(2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-trimethylsilylhept-6-ynal (PubChem CID 11067797) has the molecular formula C18H36O2Si2 and a molecular weight of 340.66 g/mol. Its IUPAC name is (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-trimethylsilylhept-6-ynal.
| Compound Name | (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-trimethylsilylhept-6-ynal |
|---|---|
| PubChem CID | 11067797 |
| Molecular Formula | C18H36O2Si2 |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-trimethylsilylhept-6-ynal |
| SMILES | CC(C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H36O2Si2/c1-15(12-11-13-21(6,7)8)17(16(2)14-19)20-22(9,10)18(3,4)5/h14-17H,12H2,1-10H3/t15-,16?,17-/m0/s1 |
| InChIKey | DRYUWEYHDFJCPS-QRFGZVGRSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|