C15H31NO4Si — CID 18678788
3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-5-oxopentanamide (PubChem CID 18678788) has the molecular formula C15H31NO4Si and a molecular weight of 317.50 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-5-oxopentanamide.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 18678788 |
| Molecular Formula | C15H31NO4Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2,4-trimethyl-5-oxopentanamide |
| SMILES | CON(C)C(=O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C15H31NO4Si/c1-11(10-17)13(12(2)14(18)16(6)19-7)20-21(8,9)15(3,4)5/h10-13H,1-9H3 |
| InChIKey | WIXDINQBKDGXJY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|