C21H41NO5Si — CID 11281464
(2R,3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-N-methoxy-N,2,4,9-tetramethyl-5-oxodec-8-enamide (PubChem CID 11281464) has the molecular formula C21H41NO5Si and a molecular weight of 415.65 g/mol. Its IUPAC name is (2R,3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-N-methoxy-N,2,4,9-tetramethyl-5-oxodec-8-enamide.
| Compound Name | (2R,3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-N-methoxy-N,2,4,9-tetramethyl-5-oxodec-8-enamide |
|---|---|
| PubChem CID | 11281464 |
| Molecular Formula | C21H41NO5Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | (2R,3S,4R,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-N-methoxy-N,2,4,9-tetramethyl-5-oxodec-8-enamide |
| SMILES | CON(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C[C@H](O)C=C(C)C |
| InChI | InChI=1S/C21H41NO5Si/c1-14(2)12-17(23)13-18(24)15(3)19(16(4)20(25)22(8)26-9)27-28(10,11)21(5,6)7/h12,15-17,19,23H,13H2,1-11H3/t15-,16+,17+,19-/m0/s1 |
| InChIKey | CKOJFVAMIGCKCH-FAJBIJEISA-N |
| XLogP | 3.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|