C14H31NO4Si — CID 11109525
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide (PubChem CID 11109525) has the molecular formula C14H31NO4Si and a molecular weight of 305.49 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 11109525 |
| Molecular Formula | C14H31NO4Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide |
| SMILES | CON(C)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)CO |
| InChI | InChI=1S/C14H31NO4Si/c1-13(2,3)20(8,9)19-11(14(4,5)10-16)12(17)15(6)18-7/h11,16H,10H2,1-9H3/t11-/m0/s1 |
| InChIKey | NDJKCIIXSGSNDB-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|