C19H35ClINO3Si — CID 25128578
(E,2S)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-7-chloro-N-methoxy-N,6-dimethylhept-5-enamide (PubChem CID 25128578) has the molecular formula C19H35ClINO3Si and a molecular weight of 515.94 g/mol. Its IUPAC name is (E,2S)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-7-chloro-N-methoxy-N,6-dimethylhept-5-enamide.
| Compound Name | (E,2S)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-7-chloro-N-methoxy-N,6-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 25128578 |
| Molecular Formula | C19H35ClINO3Si |
| Molecular Weight | 515.94 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | (E,2S)-2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-iodoprop-2-enyl]-7-chloro-N-methoxy-N,6-dimethylhept-5-enamide |
| SMILES | CON(C)C(=O)[C@@H](CC/C=C(\C)CCl)[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35ClINO3Si/c1-15(14-20)10-9-11-16(18(23)22(5)24-6)17(12-13-21)25-26(7,8)19(2,3)4/h10,12-13,16-17H,9,11,14H2,1-8H3/b13-12+,15-10+/t16-,17+/m0/s1 |
| InChIKey | VBZRHMSSPXNPES-CLWMIHADSA-N |
| XLogP | 5.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|